C17H26N2O2 — CID 64730380
N-(3-aminophenyl)-2-(3,5-dimethylcyclohexyl)oxypropanamide (PubChem CID 64730380) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(3,5-dimethylcyclohexyl)oxypropanamide.
| Compound Name | N-(3-aminophenyl)-2-(3,5-dimethylcyclohexyl)oxypropanamide |
|---|---|
| PubChem CID | 64730380 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-(3-aminophenyl)-2-(3,5-dimethylcyclohexyl)oxypropanamide |
| SMILES | CC1CC(C)CC(OC(C)C(=O)Nc2cccc(N)c2)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-11-7-12(2)9-16(8-11)21-13(3)17(20)19-15-6-4-5-14(18)10-15/h4-6,10-13,16H,7-9,18H2,1-3H3,(H,19,20) |
| InChIKey | QCTISPYGAXAEJB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|