C12H20N2S — CID 64732895
N-(3,5-dimethylcyclohexyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 64732895) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 64732895 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NC2CC(C)CC(C)C2)n1 |
| InChI | InChI=1S/C12H20N2S/c1-8-4-9(2)6-11(5-8)14-12-13-10(3)7-15-12/h7-9,11H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | ZVCBRWKFQNTHHY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |