C11H23N — CID 64733574
3,4-dimethyl-1-propan-2-ylcyclohexan-1-amine (PubChem CID 64733574) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 3,4-dimethyl-1-propan-2-ylcyclohexan-1-amine.
| Compound Name | 3,4-dimethyl-1-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64733574 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 3,4-dimethyl-1-propan-2-ylcyclohexan-1-amine |
| SMILES | CC1CCC(N)(C(C)C)CC1C |
| InChI | InChI=1S/C11H23N/c1-8(2)11(12)6-5-9(3)10(4)7-11/h8-10H,5-7,12H2,1-4H3 |
| InChIKey | MJUKSCFFFICFNO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |