C18H42 — CID 177218946
ethane;1,3,4-trimethyl-1-propan-2-ylcyclohexane (PubChem CID 177218946) has the molecular formula C18H42 and a molecular weight of 258.53 g/mol. Its IUPAC name is ethane;1,3,4-trimethyl-1-propan-2-ylcyclohexane.
| Compound Name | ethane;1,3,4-trimethyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 177218946 |
| Molecular Formula | C18H42 |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 258.33 |
| IUPAC Name | ethane;1,3,4-trimethyl-1-propan-2-ylcyclohexane |
| SMILES | CC.CC.CC.CC1CCC(C)(C(C)C)CC1C |
| InChI | InChI=1S/C12H24.3C2H6/c1-9(2)12(5)7-6-10(3)11(4)8-12;3*1-2/h9-11H,6-8H2,1-5H3;3*1-2H3 |
| InChIKey | GIMQGTAYMOFKDG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |