C16H23ClO — CID 64735526
2-(chloromethyl)-1-(3,5-dimethylcyclohexyl)oxy-4-methylbenzene (PubChem CID 64735526) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(3,5-dimethylcyclohexyl)oxy-4-methylbenzene.
| Compound Name | 2-(chloromethyl)-1-(3,5-dimethylcyclohexyl)oxy-4-methylbenzene |
|---|---|
| PubChem CID | 64735526 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(chloromethyl)-1-(3,5-dimethylcyclohexyl)oxy-4-methylbenzene |
| SMILES | Cc1ccc(OC2CC(C)CC(C)C2)c(CCl)c1 |
| InChI | InChI=1S/C16H23ClO/c1-11-4-5-16(14(7-11)10-17)18-15-8-12(2)6-13(3)9-15/h4-5,7,12-13,15H,6,8-10H2,1-3H3 |
| InChIKey | RAQMNJCLJKDJBT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|