C18H25ClO2 — CID 79900246
4-[2-(chloromethyl)-4-methylphenoxy]-1-oxaspiro[5.5]undecane (PubChem CID 79900246) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is 4-[2-(chloromethyl)-4-methylphenoxy]-1-oxaspiro[5.5]undecane.
| Compound Name | 4-[2-(chloromethyl)-4-methylphenoxy]-1-oxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79900246 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[2-(chloromethyl)-4-methylphenoxy]-1-oxaspiro[5.5]undecane |
| SMILES | Cc1ccc(OC2CCOC3(CCCCC3)C2)c(CCl)c1 |
| InChI | InChI=1S/C18H25ClO2/c1-14-5-6-17(15(11-14)13-19)21-16-7-10-20-18(12-16)8-3-2-4-9-18/h5-6,11,16H,2-4,7-10,12-13H2,1H3 |
| InChIKey | RJTSUNJRYALELP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|