C17H23ClO3 — CID 79899956
9-[2-(chloromethyl)-4-methoxyphenoxy]-6-oxaspiro[4.5]decane (PubChem CID 79899956) has the molecular formula C17H23ClO3 and a molecular weight of 310.82 g/mol. Its IUPAC name is 9-[2-(chloromethyl)-4-methoxyphenoxy]-6-oxaspiro[4.5]decane.
| Compound Name | 9-[2-(chloromethyl)-4-methoxyphenoxy]-6-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 79899956 |
| Molecular Formula | C17H23ClO3 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 9-[2-(chloromethyl)-4-methoxyphenoxy]-6-oxaspiro[4.5]decane |
| SMILES | COc1ccc(OC2CCOC3(CCCC3)C2)c(CCl)c1 |
| InChI | InChI=1S/C17H23ClO3/c1-19-14-4-5-16(13(10-14)12-18)21-15-6-9-20-17(11-15)7-2-3-8-17/h4-5,10,15H,2-3,6-9,11-12H2,1H3 |
| InChIKey | MVGPGYXWULPBBI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|