C18H26O3 — CID 107713039
2-[2-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]ethanol (PubChem CID 107713039) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[2-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]ethanol.
| Compound Name | 2-[2-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107713039 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[2-(1-oxaspiro[5.5]undecan-4-yloxy)phenyl]ethanol |
| SMILES | OCCc1ccccc1OC1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C18H26O3/c19-12-8-15-6-2-3-7-17(15)21-16-9-13-20-18(14-16)10-4-1-5-11-18/h2-3,6-7,16,19H,1,4-5,8-14H2 |
| InChIKey | RFDYRNLXLAEIEM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |