C15H23N3O — CID 64738505
3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzamide (PubChem CID 64738505) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzamide.
| Compound Name | 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzamide |
|---|---|
| PubChem CID | 64738505 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzamide |
| SMILES | CC1CCC(Nc2ccc(C(N)=O)cc2N)CC1C |
| InChI | InChI=1S/C15H23N3O/c1-9-3-5-12(7-10(9)2)18-14-6-4-11(15(17)19)8-13(14)16/h4,6,8-10,12,18H,3,5,7,16H2,1-2H3,(H2,17,19) |
| InChIKey | QLRSXJMZQVYXOE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|