C15H21N3 — CID 64740902
3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzonitrile (PubChem CID 64740902) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzonitrile.
| Compound Name | 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 64740902 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-amino-4-[(3,4-dimethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1CCC(Nc2ccc(C#N)cc2N)CC1C |
| InChI | InChI=1S/C15H21N3/c1-10-3-5-13(7-11(10)2)18-15-6-4-12(9-16)8-14(15)17/h4,6,8,10-11,13,18H,3,5,7,17H2,1-2H3 |
| InChIKey | DBNTZCGLBCRFCO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|