C16H21NO — CID 64739371
2-[4-(3,4-dimethylcyclohexyl)oxyphenyl]acetonitrile (PubChem CID 64739371) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylcyclohexyl)oxyphenyl]acetonitrile.
| Compound Name | 2-[4-(3,4-dimethylcyclohexyl)oxyphenyl]acetonitrile |
|---|---|
| PubChem CID | 64739371 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-[4-(3,4-dimethylcyclohexyl)oxyphenyl]acetonitrile |
| SMILES | CC1CCC(Oc2ccc(CC#N)cc2)CC1C |
| InChI | InChI=1S/C16H21NO/c1-12-3-6-16(11-13(12)2)18-15-7-4-14(5-8-15)9-10-17/h4-5,7-8,12-13,16H,3,6,9,11H2,1-2H3 |
| InChIKey | DCJJUDRCQWHPQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |