C17H26N2 — CID 64739984
1-(3,4-dimethylcyclohexyl)-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 64739984) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-3,4-dihydro-2H-quinolin-7-amine.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-3,4-dihydro-2H-quinolin-7-amine |
|---|---|
| PubChem CID | 64739984 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | CC1CCC(N2CCCc3ccc(N)cc32)CC1C |
| InChI | InChI=1S/C17H26N2/c1-12-5-8-16(10-13(12)2)19-9-3-4-14-6-7-15(18)11-17(14)19/h6-7,11-13,16H,3-5,8-10,18H2,1-2H3 |
| InChIKey | VWAMUNWXODUGRI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|