C15H20BrClO — CID 64740768
2-(bromomethyl)-4-chloro-1-(3,4-dimethylcyclohexyl)oxybenzene (PubChem CID 64740768) has the molecular formula C15H20BrClO and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chloro-1-(3,4-dimethylcyclohexyl)oxybenzene.
| Compound Name | 2-(bromomethyl)-4-chloro-1-(3,4-dimethylcyclohexyl)oxybenzene |
|---|---|
| PubChem CID | 64740768 |
| Molecular Formula | C15H20BrClO |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(bromomethyl)-4-chloro-1-(3,4-dimethylcyclohexyl)oxybenzene |
| SMILES | CC1CCC(Oc2ccc(Cl)cc2CBr)CC1C |
| InChI | InChI=1S/C15H20BrClO/c1-10-3-5-14(7-11(10)2)18-15-6-4-13(17)8-12(15)9-16/h4,6,8,10-11,14H,3,5,7,9H2,1-2H3 |
| InChIKey | FWWYUACVZJMGCO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|