C18H23NO2 — CID 64741251
N-(3,4-dimethylcyclohexyl)-2-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 64741251) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 64741251 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2ccccc2C#CCO)CC1C |
| InChI | InChI=1S/C18H23NO2/c1-13-9-10-16(12-14(13)2)19-18(21)17-8-4-3-6-15(17)7-5-11-20/h3-4,6,8,13-14,16,20H,9-12H2,1-2H3,(H,19,21) |
| InChIKey | LWFVDIJFHHBVMY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|