C20H31N — CID 64743368
N-(3-ethylcyclohexyl)-2-phenylcyclohexan-1-amine (PubChem CID 64743368) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is N-(3-ethylcyclohexyl)-2-phenylcyclohexan-1-amine.
| Compound Name | N-(3-ethylcyclohexyl)-2-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64743368 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-(3-ethylcyclohexyl)-2-phenylcyclohexan-1-amine |
| SMILES | CCC1CCCC(NC2CCCCC2c2ccccc2)C1 |
| InChI | InChI=1S/C20H31N/c1-2-16-9-8-12-18(15-16)21-20-14-7-6-13-19(20)17-10-4-3-5-11-17/h3-5,10-11,16,18-21H,2,6-9,12-15H2,1H3 |
| InChIKey | XUSCCDKLDFBKJO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |