C14H23N — CID 64743596
1-(3-ethylcyclohexyl)-2,5-dimethylpyrrole (PubChem CID 64743596) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(3-ethylcyclohexyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 64743596 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-2,5-dimethylpyrrole |
| SMILES | CCC1CCCC(n2c(C)ccc2C)C1 |
| InChI | InChI=1S/C14H23N/c1-4-13-6-5-7-14(10-13)15-11(2)8-9-12(15)3/h8-9,13-14H,4-7,10H2,1-3H3 |
| InChIKey | QMSWRQFFGIJEIR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |