C10H13N3O2S2 — CID 6474578
[(E)-(4-ethylsulfonylphenyl)methylideneamino]thiourea (PubChem CID 6474578) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is [(E)-(4-ethylsulfonylphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(4-ethylsulfonylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6474578 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | [(E)-(4-ethylsulfonylphenyl)methylideneamino]thiourea |
| SMILES | CCS(=O)(=O)c1ccc(/C=N/NC(N)=S)cc1 |
| InChI | InChI=1S/C10H13N3O2S2/c1-2-17(14,15)9-5-3-8(4-6-9)7-12-13-10(11)16/h3-7H,2H2,1H3,(H3,11,13,16)/b12-7+ |
| InChIKey | VUSKMERTTCJJPM-KPKJPENVSA-N |
| XLogP | 0.65 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|