C11H13N3O2S2 — CID 70690662
[(E)-(6-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 70690662) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is [(E)-(6-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
| Compound Name | [(E)-(6-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 70690662 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | [(E)-(6-methyl-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | Cc1ccc2c(c1)/C(=N/NC(N)=S)CCS2(=O)=O |
| InChI | InChI=1S/C11H13N3O2S2/c1-7-2-3-10-8(6-7)9(13-14-11(12)17)4-5-18(10,15)16/h2-3,6H,4-5H2,1H3,(H3,12,14,17)/b13-9+ |
| InChIKey | LKGIXZZBEOTOFW-UKTHLTGXSA-N |
| XLogP | 0.71 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|