C18H28O3 — CID 64746862
1-(3,4-diethoxyphenyl)-3,4-dimethylcyclohexan-1-ol (PubChem CID 64746862) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3,4-dimethylcyclohexan-1-ol.
| Compound Name | 1-(3,4-diethoxyphenyl)-3,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 64746862 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3,4-dimethylcyclohexan-1-ol |
| SMILES | CCOc1ccc(C2(O)CCC(C)C(C)C2)cc1OCC |
| InChI | InChI=1S/C18H28O3/c1-5-20-16-8-7-15(11-17(16)21-6-2)18(19)10-9-13(3)14(4)12-18/h7-8,11,13-14,19H,5-6,9-10,12H2,1-4H3 |
| InChIKey | ZPTZKZAKZJQHMU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |