C18H28O2 — CID 64750729
3,5-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)cyclohexan-1-ol (PubChem CID 64750729) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 3,5-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)cyclohexan-1-ol.
| Compound Name | 3,5-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 64750729 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 3,5-dimethyl-2-(5-methyl-2-propan-2-ylphenoxy)cyclohexan-1-ol |
| SMILES | Cc1ccc(C(C)C)c(OC2C(C)CC(C)CC2O)c1 |
| InChI | InChI=1S/C18H28O2/c1-11(2)15-7-6-12(3)10-17(15)20-18-14(5)8-13(4)9-16(18)19/h6-7,10-11,13-14,16,18-19H,8-9H2,1-5H3 |
| InChIKey | WYHMAQDELMJGMW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |