C12H8O2 — CID 6475136
(5E)-5-[(Z)-oct-6-en-2,4-diynylidene]furan-2-one (PubChem CID 6475136) has the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. Its IUPAC name is (5E)-5-[(Z)-oct-6-en-2,4-diynylidene]furan-2-one.
| Compound Name | (5E)-5-[(Z)-oct-6-en-2,4-diynylidene]furan-2-one |
|---|---|
| PubChem CID | 6475136 |
| Molecular Formula | C12H8O2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (5E)-5-[(Z)-oct-6-en-2,4-diynylidene]furan-2-one |
| SMILES | C/C=C\C#CC#C/C=C1\C=CC(=O)O1 |
| InChI | InChI=1S/C12H8O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h2-3,8-10H,1H3/b3-2-,11-8+ |
| InChIKey | KQBDGBICBAYCGE-IVAFBWBGSA-N |
| XLogP | 1.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|