C15H29NO — CID 64752391
2-cyclobutyloxy-3,5-dimethyl-N-propylcyclohexan-1-amine (PubChem CID 64752391) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2-cyclobutyloxy-3,5-dimethyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-cyclobutyloxy-3,5-dimethyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752391 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2-cyclobutyloxy-3,5-dimethyl-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CC(C)CC(C)C1OC1CCC1 |
| InChI | InChI=1S/C15H29NO/c1-4-8-16-14-10-11(2)9-12(3)15(14)17-13-6-5-7-13/h11-16H,4-10H2,1-3H3 |
| InChIKey | ZQGGNJUDIFHIAY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |