C18H37NO — CID 64752974
2-heptoxy-3,5-dimethyl-N-propylcyclohexan-1-amine (PubChem CID 64752974) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is 2-heptoxy-3,5-dimethyl-N-propylcyclohexan-1-amine.
| Compound Name | 2-heptoxy-3,5-dimethyl-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752974 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 2-heptoxy-3,5-dimethyl-N-propylcyclohexan-1-amine |
| SMILES | CCCCCCCOC1C(C)CC(C)CC1NCCC |
| InChI | InChI=1S/C18H37NO/c1-5-7-8-9-10-12-20-18-16(4)13-15(3)14-17(18)19-11-6-2/h15-19H,5-14H2,1-4H3 |
| InChIKey | VBCOLJUBUXPMBX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|