C16H33NO — CID 64752776
2-heptoxy-N,3,5-trimethylcyclohexan-1-amine (PubChem CID 64752776) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-heptoxy-N,3,5-trimethylcyclohexan-1-amine.
| Compound Name | 2-heptoxy-N,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752776 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 2-heptoxy-N,3,5-trimethylcyclohexan-1-amine |
| SMILES | CCCCCCCOC1C(C)CC(C)CC1NC |
| InChI | InChI=1S/C16H33NO/c1-5-6-7-8-9-10-18-16-14(3)11-13(2)12-15(16)17-4/h13-17H,5-12H2,1-4H3 |
| InChIKey | YKKTULAWQXEJLC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|