C14H29NS — CID 107762877
N,3,5-trimethyl-2-pentylsulfanylcyclohexan-1-amine (PubChem CID 107762877) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is N,3,5-trimethyl-2-pentylsulfanylcyclohexan-1-amine.
| Compound Name | N,3,5-trimethyl-2-pentylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 107762877 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N,3,5-trimethyl-2-pentylsulfanylcyclohexan-1-amine |
| SMILES | CCCCCSC1C(C)CC(C)CC1NC |
| InChI | InChI=1S/C14H29NS/c1-5-6-7-8-16-14-12(3)9-11(2)10-13(14)15-4/h11-15H,5-10H2,1-4H3 |
| InChIKey | DFWXJHMSTNQUSC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|