C14H29NO2S — CID 64752897
3,5-dimethyl-N-propyl-2-propylsulfonylcyclohexan-1-amine (PubChem CID 64752897) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is 3,5-dimethyl-N-propyl-2-propylsulfonylcyclohexan-1-amine.
| Compound Name | 3,5-dimethyl-N-propyl-2-propylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752897 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3,5-dimethyl-N-propyl-2-propylsulfonylcyclohexan-1-amine |
| SMILES | CCCNC1CC(C)CC(C)C1S(=O)(=O)CCC |
| InChI | InChI=1S/C14H29NO2S/c1-5-7-15-13-10-11(3)9-12(4)14(13)18(16,17)8-6-2/h11-15H,5-10H2,1-4H3 |
| InChIKey | DCRIKQNEGZAYMF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |