C15H22F3NS — CID 64754879
N-(1-thiophen-2-ylbutyl)-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64754879) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-(1-thiophen-2-ylbutyl)-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(1-thiophen-2-ylbutyl)-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64754879 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(1-thiophen-2-ylbutyl)-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCCC(NC1CCC(C(F)(F)F)CC1)c1cccs1 |
| InChI | InChI=1S/C15H22F3NS/c1-2-4-13(14-5-3-10-20-14)19-12-8-6-11(7-9-12)15(16,17)18/h3,5,10-13,19H,2,4,6-9H2,1H3 |
| InChIKey | GHIPESBAPGZKEE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |