C14H23NS2 — CID 79957676
2-methyl-N-(1-thiophen-2-ylbutyl)thian-3-amine (PubChem CID 79957676) has the molecular formula C14H23NS2 and a molecular weight of 269.48 g/mol. Its IUPAC name is 2-methyl-N-(1-thiophen-2-ylbutyl)thian-3-amine.
| Compound Name | 2-methyl-N-(1-thiophen-2-ylbutyl)thian-3-amine |
|---|---|
| PubChem CID | 79957676 |
| Molecular Formula | C14H23NS2 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-methyl-N-(1-thiophen-2-ylbutyl)thian-3-amine |
| SMILES | CCCC(NC1CCCSC1C)c1cccs1 |
| InChI | InChI=1S/C14H23NS2/c1-3-6-13(14-8-5-10-17-14)15-12-7-4-9-16-11(12)2/h5,8,10-13,15H,3-4,6-7,9H2,1-2H3 |
| InChIKey | FFKVTFCMZVEDOJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |