C12H19NS2 — CID 81398612
2-methyl-N-[(1S)-1-thiophen-2-ylethyl]thian-3-amine (PubChem CID 81398612) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-1-thiophen-2-ylethyl]thian-3-amine.
| Compound Name | 2-methyl-N-[(1S)-1-thiophen-2-ylethyl]thian-3-amine |
|---|---|
| PubChem CID | 81398612 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-methyl-N-[(1S)-1-thiophen-2-ylethyl]thian-3-amine |
| SMILES | CC1SCCCC1N[C@@H](C)c1cccs1 |
| InChI | InChI=1S/C12H19NS2/c1-9(12-6-4-8-15-12)13-11-5-3-7-14-10(11)2/h4,6,8-11,13H,3,5,7H2,1-2H3/t9-,10?,11?/m0/s1 |
| InChIKey | HLAKWYHYERJXJY-WHXUTIOJSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |