C14H20BrNS — CID 81353696
N-[(1R)-1-(4-bromophenyl)ethyl]-2-methylthian-3-amine (PubChem CID 81353696) has the molecular formula C14H20BrNS and a molecular weight of 314.29 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-2-methylthian-3-amine.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-methylthian-3-amine |
|---|---|
| PubChem CID | 81353696 |
| Molecular Formula | C14H20BrNS |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-methylthian-3-amine |
| SMILES | CC1SCCCC1N[C@H](C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrNS/c1-10(12-5-7-13(15)8-6-12)16-14-4-3-9-17-11(14)2/h5-8,10-11,14,16H,3-4,9H2,1-2H3/t10-,11?,14?/m1/s1 |
| InChIKey | IDRPIDBJUQJRQV-CDWSIMAYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |