C11H17NS2 — CID 102684058
2-methyl-N-[(1R)-1-thiophen-2-ylethyl]thiolan-3-amine (PubChem CID 102684058) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]thiolan-3-amine.
| Compound Name | 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 102684058 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]thiolan-3-amine |
| SMILES | CC1SCCC1N[C@H](C)c1cccs1 |
| InChI | InChI=1S/C11H17NS2/c1-8(11-4-3-6-14-11)12-10-5-7-13-9(10)2/h3-4,6,8-10,12H,5,7H2,1-2H3/t8-,9?,10?/m1/s1 |
| InChIKey | WYKMRWRLXZSOPU-XNWIYYODSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |