C18H29NS — CID 81398668
2-cyclohexyl-N-[(1S)-1-thiophen-2-ylethyl]cyclohexan-1-amine (PubChem CID 81398668) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is 2-cyclohexyl-N-[(1S)-1-thiophen-2-ylethyl]cyclohexan-1-amine.
| Compound Name | 2-cyclohexyl-N-[(1S)-1-thiophen-2-ylethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 81398668 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-cyclohexyl-N-[(1S)-1-thiophen-2-ylethyl]cyclohexan-1-amine |
| SMILES | C[C@H](NC1CCCCC1C1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C18H29NS/c1-14(18-12-7-13-20-18)19-17-11-6-5-10-16(17)15-8-3-2-4-9-15/h7,12-17,19H,2-6,8-11H2,1H3/t14-,16?,17?/m0/s1 |
| InChIKey | OGROIFHMLUXVLU-OOHWJJMZSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |