C15H24N2S — CID 81398761
2-pyrrolidin-2-yl-N-[(1S)-1-thiophen-2-ylethyl]cyclopentan-1-amine (PubChem CID 81398761) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-[(1S)-1-thiophen-2-ylethyl]cyclopentan-1-amine.
| Compound Name | 2-pyrrolidin-2-yl-N-[(1S)-1-thiophen-2-ylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 81398761 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-[(1S)-1-thiophen-2-ylethyl]cyclopentan-1-amine |
| SMILES | C[C@H](NC1CCCC1C1CCCN1)c1cccs1 |
| InChI | InChI=1S/C15H24N2S/c1-11(15-8-4-10-18-15)17-14-6-2-5-12(14)13-7-3-9-16-13/h4,8,10-14,16-17H,2-3,5-7,9H2,1H3/t11-,12?,13?,14?/m0/s1 |
| InChIKey | TZKCUGJQPRNTTR-YWLNHKIPSA-N |
| XLogP | 3.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |