C14H22N2S — CID 81398172
8-methyl-N-[(1R)-1-thiophen-2-ylethyl]-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 81398172) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 8-methyl-N-[(1R)-1-thiophen-2-ylethyl]-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-methyl-N-[(1R)-1-thiophen-2-ylethyl]-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 81398172 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 8-methyl-N-[(1R)-1-thiophen-2-ylethyl]-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | C[C@@H](NC1CC2CCC(C1)N2C)c1cccs1 |
| InChI | InChI=1S/C14H22N2S/c1-10(14-4-3-7-17-14)15-11-8-12-5-6-13(9-11)16(12)2/h3-4,7,10-13,15H,5-6,8-9H2,1-2H3/t10-,11?,12?,13?/m1/s1 |
| InChIKey | CEQJZKFRHZADRW-PEWWYSNMSA-N |
| XLogP | 3.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |