C13H20F3NO — CID 64756878
[2-(2,2,2-trifluoroethylamino)-2-adamantyl]methanol (PubChem CID 64756878) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethylamino)-2-adamantyl]methanol.
| Compound Name | [2-(2,2,2-trifluoroethylamino)-2-adamantyl]methanol |
|---|---|
| PubChem CID | 64756878 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [2-(2,2,2-trifluoroethylamino)-2-adamantyl]methanol |
| SMILES | OCC1(NCC(F)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H20F3NO/c14-13(15,16)6-17-12(7-18)10-2-8-1-9(4-10)5-11(12)3-8/h8-11,17-18H,1-7H2 |
| InChIKey | GIYBYMZHKVLJEB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |