C14H27F3N2O — CID 64757409
1-(aminomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64757409) has the molecular formula C14H27F3N2O and a molecular weight of 296.38 g/mol. Its IUPAC name is 1-(aminomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64757409 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-(aminomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCN(C(C)COC)C1(CN)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H27F3N2O/c1-4-19(11(2)9-20-3)13(10-18)7-5-6-12(8-13)14(15,16)17/h11-12H,4-10,18H2,1-3H3 |
| InChIKey | QDVFANARSNALBZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |