C9H7BrClF3O2S — CID 64757505
1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-chlorobenzene (PubChem CID 64757505) has the molecular formula C9H7BrClF3O2S and a molecular weight of 351.57 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-chlorobenzene.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-chlorobenzene |
|---|---|
| PubChem CID | 64757505 |
| Molecular Formula | C9H7BrClF3O2S |
| Molecular Weight | 351.57 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-chlorobenzene |
| SMILES | O=S(=O)(CC(Br)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C9H7BrClF3O2S/c10-8(9(12,13)14)5-17(15,16)7-4-2-1-3-6(7)11/h1-4,8H,5H2 |
| InChIKey | VVBAQMPJCIKLKY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|