C18H31N5O7 — CID 6475796
(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]butanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid (PubChem CID 6475796) has the molecular formula C18H31N5O7 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]butanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]butanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6475796 |
| Molecular Formula | C18H31N5O7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]butanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CNC(=O)/C=C/C(=O)OC)C(=O)O |
| InChI | InChI=1S/C18H31N5O7/c1-3-12(22-16(26)11(20)6-4-5-9-19)17(27)23-13(18(28)29)10-21-14(24)7-8-15(25)30-2/h7-8,11-13H,3-6,9-10,19-20H2,1-2H3,(H,21,24)(H,22,26)(H,23,27)(H,28,29)/b8-7+/t11-,12-,13-/m0/s1 |
| InChIKey | OLDLPGRERWUOKW-UNNQQDACSA-N |
| XLogP | -2.25 |
| TPSA | 202.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|