C14H17F4N — CID 64757984
1-(5-fluoro-2-methylphenyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64757984) has the molecular formula C14H17F4N and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64757984 |
| Molecular Formula | C14H17F4N |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | Cc1ccc(F)cc1C1(N)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F4N/c1-9-4-5-11(15)7-12(9)13(19)6-2-3-10(8-13)14(16,17)18/h4-5,7,10H,2-3,6,8,19H2,1H3 |
| InChIKey | VBAVUFHAMRSDSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |