C10H7BrF3NO — CID 64758929
2-(2-bromo-3,3,3-trifluoropropoxy)benzonitrile (PubChem CID 64758929) has the molecular formula C10H7BrF3NO and a molecular weight of 294.07 g/mol. Its IUPAC name is 2-(2-bromo-3,3,3-trifluoropropoxy)benzonitrile.
| Compound Name | 2-(2-bromo-3,3,3-trifluoropropoxy)benzonitrile |
|---|---|
| PubChem CID | 64758929 |
| Molecular Formula | C10H7BrF3NO |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-(2-bromo-3,3,3-trifluoropropoxy)benzonitrile |
| SMILES | N#Cc1ccccc1OCC(Br)C(F)(F)F |
| InChI | InChI=1S/C10H7BrF3NO/c11-9(10(12,13)14)6-16-8-4-2-1-3-7(8)5-15/h1-4,9H,6H2 |
| InChIKey | IUDDMVFYLSYEAH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|