C12H13BrF3N3 — CID 64758935
3-[(2-bromo-3,3,3-trifluoropropyl)-(pyridin-3-ylmethyl)amino]propanenitrile (PubChem CID 64758935) has the molecular formula C12H13BrF3N3 and a molecular weight of 336.16 g/mol. Its IUPAC name is 3-[(2-bromo-3,3,3-trifluoropropyl)-(pyridin-3-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(2-bromo-3,3,3-trifluoropropyl)-(pyridin-3-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 64758935 |
| Molecular Formula | C12H13BrF3N3 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-[(2-bromo-3,3,3-trifluoropropyl)-(pyridin-3-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1cccnc1)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C12H13BrF3N3/c13-11(12(14,15)16)9-19(6-2-4-17)8-10-3-1-5-18-7-10/h1,3,5,7,11H,2,6,8-9H2 |
| InChIKey | YBSKMQMWLIERIJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|