C13H18BrN3 — CID 64995711
3-[(3-bromo-2-methylpropyl)-(pyridin-3-ylmethyl)amino]propanenitrile (PubChem CID 64995711) has the molecular formula C13H18BrN3 and a molecular weight of 296.21 g/mol. Its IUPAC name is 3-[(3-bromo-2-methylpropyl)-(pyridin-3-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(3-bromo-2-methylpropyl)-(pyridin-3-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 64995711 |
| Molecular Formula | C13H18BrN3 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-[(3-bromo-2-methylpropyl)-(pyridin-3-ylmethyl)amino]propanenitrile |
| SMILES | CC(CBr)CN(CCC#N)Cc1cccnc1 |
| InChI | InChI=1S/C13H18BrN3/c1-12(8-14)10-17(7-3-5-15)11-13-4-2-6-16-9-13/h2,4,6,9,12H,3,7-8,10-11H2,1H3 |
| InChIKey | GOBJKICTDWOOOP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|