C16H29F3N2 — CID 64760026
1-(aminomethyl)-N-cyclohexyl-N-ethyl-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64760026) has the molecular formula C16H29F3N2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 1-(aminomethyl)-N-cyclohexyl-N-ethyl-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-cyclohexyl-N-ethyl-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64760026 |
| Molecular Formula | C16H29F3N2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-(aminomethyl)-N-cyclohexyl-N-ethyl-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCN(C1CCCCC1)C1(CN)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H29F3N2/c1-2-21(14-8-4-3-5-9-14)15(12-20)10-6-7-13(11-15)16(17,18)19/h13-14H,2-12,20H2,1H3 |
| InChIKey | NZLIFYSICAXROV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |