C15H19ClF3N — CID 64761788
4-chloro-N-(2,4-dimethylcyclohexyl)-3-(trifluoromethyl)aniline (PubChem CID 64761788) has the molecular formula C15H19ClF3N and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethylcyclohexyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-(2,4-dimethylcyclohexyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 64761788 |
| Molecular Formula | C15H19ClF3N |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-chloro-N-(2,4-dimethylcyclohexyl)-3-(trifluoromethyl)aniline |
| SMILES | CC1CCC(Nc2ccc(Cl)c(C(F)(F)F)c2)C(C)C1 |
| InChI | InChI=1S/C15H19ClF3N/c1-9-3-6-14(10(2)7-9)20-11-4-5-13(16)12(8-11)15(17,18)19/h4-5,8-10,14,20H,3,6-7H2,1-2H3 |
| InChIKey | PYEWQODFCVQCLV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |