C18H29N — CID 64776351
4-tert-butyl-N-(2,4-dimethylcyclohexyl)aniline (PubChem CID 64776351) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,4-dimethylcyclohexyl)aniline.
| Compound Name | 4-tert-butyl-N-(2,4-dimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 64776351 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 4-tert-butyl-N-(2,4-dimethylcyclohexyl)aniline |
| SMILES | CC1CCC(Nc2ccc(C(C)(C)C)cc2)C(C)C1 |
| InChI | InChI=1S/C18H29N/c1-13-6-11-17(14(2)12-13)19-16-9-7-15(8-10-16)18(3,4)5/h7-10,13-14,17,19H,6,11-12H2,1-5H3 |
| InChIKey | VPLGVTRTHKGQAA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |