2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid

C13H25NO2 — CID 64762107

IUPAC2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid
SMILESCC1CCC(C)C(NC(C(=O)O)C(C)C)C1
InChIInChI=1S/C13H25NO2/c1-8(2)12(13(15)16)14-11-7-9(3)5-6-10(11)4/h8-12,14H,5-7H2,1-4H3,(H,15,16)
InChIKeyXEFCQZQZFPSYRT-UHFFFAOYSA-N
MW227.35 g/mol
LogP2.51
Rot. Bonds4

About 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid

2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid (PubChem CID 64762107) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid
PubChem CID64762107
Molecular FormulaC13H25NO2
Molecular Weight227.35 g/mol
Exact Mass227.19
IUPAC Name2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid
SMILESCC1CCC(C)C(NC(C(=O)O)C(C)C)C1
InChIInChI=1S/C13H25NO2/c1-8(2)12(13(15)16)14-11-7-9(3)5-6-10(11)4/h8-12,14H,5-7H2,1-4H3,(H,15,16)
InChIKeyXEFCQZQZFPSYRT-UHFFFAOYSA-N
XLogP2.51
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.35
LogP ≤ 52.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid?
The IUPAC name of 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid (CID 64762107) is 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid.
What is the SMILES notation for 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid?
The canonical SMILES for 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid is CC1CCC(C)C(NC(C(=O)O)C(C)C)C1.
What is the InChIKey of 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid?
The InChIKey is XEFCQZQZFPSYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-8(2)12(13(15)16)14-11-7-9(3)5-6-10(11)4/h8-12,14H,5-7H2,1-4H3,(H,15,16).
What are the key properties of 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid?
2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid has a molecular weight of 227.35 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylcyclohexyl)amino]-3-methylbutanoic acid is sourced from PubChem (CID 64762107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).