C13H25NO2 — CID 106662418
3-methyl-2-[(2,4,4-trimethylcyclopentyl)amino]butanoic acid (PubChem CID 106662418) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-methyl-2-[(2,4,4-trimethylcyclopentyl)amino]butanoic acid.
| Compound Name | 3-methyl-2-[(2,4,4-trimethylcyclopentyl)amino]butanoic acid |
|---|---|
| PubChem CID | 106662418 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 3-methyl-2-[(2,4,4-trimethylcyclopentyl)amino]butanoic acid |
| SMILES | CC(C)C(NC1CC(C)(C)CC1C)C(=O)O |
| InChI | InChI=1S/C13H25NO2/c1-8(2)11(12(15)16)14-10-7-13(4,5)6-9(10)3/h8-11,14H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | BXESUPVMPNBDOL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |