C16H23NO2 — CID 106662453
2-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]acetic acid (PubChem CID 106662453) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]acetic acid.
| Compound Name | 2-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]acetic acid |
|---|---|
| PubChem CID | 106662453 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]acetic acid |
| SMILES | CC1CC(C)(C)CC1NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-11-9-16(2,3)10-13(11)17-14(15(18)19)12-7-5-4-6-8-12/h4-8,11,13-14,17H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | NWYLLJJZFUBWHY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |