2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid

C14H19NO3 — CID 112633963

IUPAC2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid
SMILESCC1(C)C(O)CC1NC(C(=O)O)c1ccccc1
InChIInChI=1S/C14H19NO3/c1-14(2)10(8-11(14)16)15-12(13(17)18)9-6-4-3-5-7-9/h3-7,10-12,15-16H,8H2,1-2H3,(H,17,18)
InChIKeyVWTHDNMFGBOYJD-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.56
Rot. Bonds4

About 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid

2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid (PubChem CID 112633963) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid.

Molecular Properties

Compound Name2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid
PubChem CID112633963
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Name2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid
SMILESCC1(C)C(O)CC1NC(C(=O)O)c1ccccc1
InChIInChI=1S/C14H19NO3/c1-14(2)10(8-11(14)16)15-12(13(17)18)9-6-4-3-5-7-9/h3-7,10-12,15-16H,8H2,1-2H3,(H,17,18)
InChIKeyVWTHDNMFGBOYJD-UHFFFAOYSA-N
XLogP1.56
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid?
The IUPAC name of 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid (CID 112633963) is 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid.
What is the SMILES notation for 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid?
The canonical SMILES for 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid is CC1(C)C(O)CC1NC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid?
The InChIKey is VWTHDNMFGBOYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-14(2)10(8-11(14)16)15-12(13(17)18)9-6-4-3-5-7-9/h3-7,10-12,15-16H,8H2,1-2H3,(H,17,18).
What are the key properties of 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid?
2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid has a molecular weight of 249.31 g/mol, XLogP of 1.56, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-hydroxy-2,2-dimethylcyclobutyl)amino]-2-phenylacetic acid is sourced from PubChem (CID 112633963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).