C17H25NO2 — CID 122037832
(2R)-3-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]propanoic acid (PubChem CID 122037832) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]propanoic acid |
|---|---|
| PubChem CID | 122037832 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2R)-3-phenyl-2-[(2,4,4-trimethylcyclopentyl)amino]propanoic acid |
| SMILES | CC1CC(C)(C)CC1N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25NO2/c1-12-10-17(2,3)11-15(12)18-14(16(19)20)9-13-7-5-4-6-8-13/h4-8,12,14-15,18H,9-11H2,1-3H3,(H,19,20)/t12?,14-,15?/m1/s1 |
| InChIKey | PEJACJZDNBUYLV-HNFVBEJKSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |